| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:02 UTC |
|---|
| Update Date | 2025-03-25 00:59:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235707 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H20O3 |
|---|
| Molecular Mass | 272.1412 |
|---|
| SMILES | COc1ccc2c(c1)C13CCCCC1C(C2)OC(=O)C3 |
|---|
| InChI Key | KEAJXGLOIKTCEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanestetralins |
|---|
| Substituents | tetralinphenol etherphenanthrenecarbonyl groupetherdelta valerolactonealkyl aryl ethercarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundanisolecarboxylic acid esterhydrocarbon derivativeoxanedelta_valerolactoneorganoheterocyclic compoundorganooxygen compound |
|---|
