| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:04 UTC |
|---|
| Update Date | 2025-03-25 00:59:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235787 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11N3O4 |
|---|
| Molecular Mass | 261.075 |
|---|
| SMILES | COc1ccc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1 |
|---|
| InChI Key | ZTLUUBJURMAMGA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesalkyl aryl ethersanisolesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsmethoxybenzenesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspyrimidinecarboxylic acids and derivativespyrimidonessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | phenol etheretherlactamaromatic heteromonocyclic compoundpyrimidonealkyl aryl ethercarboxylic acid derivative2-heteroaryl carboxamidepyrimidinearomatic anilideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupmethoxybenzenesecondary carboxylic acid amideorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundpyrimidine-6-carboxylic acid or derivativesorganooxygen compound |
|---|
