| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:04 UTC |
|---|
| Update Date | 2025-03-25 00:59:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235788 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15NO7 |
|---|
| Molecular Mass | 285.0849 |
|---|
| SMILES | COc1ccc(N2OC(C(=O)O)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | VQDDHAVGHZLCQX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenol ethers |
|---|
| Subclass | anisoles |
|---|
| Direct Parent | anisoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,2-oxazinanes1-hydroxylamino, 2-unsubstituted benzenoidsalkanolaminesalkyl aryl ethersazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesn-organohydroxylaminesn-phenylhydroxylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundssecondary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundalkyl aryl ether1,2-oxazinanecarboxylic acid derivativebeta-hydroxy acidorganic oxideorganonitrogen compoundorganopnictogen compound1-hydroxylamino, 2-unsubstituted benzenoidorganoheterocyclic compoundalkanolamine1,2-diolalcoholazacyclehydroxy acidmethoxybenzenen-organohydroxylamineoxazinaneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolen-phenylhydroxylaminesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
