| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:04 UTC |
|---|
| Update Date | 2025-03-25 00:59:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235789 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21N3O2 |
|---|
| Molecular Mass | 263.1634 |
|---|
| SMILES | COc1ccc(N2CCN(C(=O)CCN)CC2)cc1 |
|---|
| InChI Key | ODCJIWJGRKTIJU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaminophenyl ethersaniline and substituted anilinesanisolesazacyclic compoundsbeta amino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesmethoxybenzenesmonoalkylaminesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenoxy compoundstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineazacycleaniline or substituted anilinescarboxamide groupmethoxybenzenebeta amino acid or derivativesphenylpiperazineorganic oxygen compoundanisolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
