| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:04 UTC |
|---|
| Update Date | 2025-03-25 00:59:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235790 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O3 |
|---|
| Molecular Mass | 238.1317 |
|---|
| SMILES | COc1ccc(NC(=O)CC(C)N)c(OC)c1 |
|---|
| InChI Key | BDECIABHEGRDOO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanilidesanisolescarbonyl compoundscarboxylic acids and derivativesdimethoxybenzenesfatty amideshydrocarbon derivativesmonoalkylaminesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylphenol ethermonocyclic benzene moietycarbonyl groupetherfatty amiden-arylamidealkyl aryl etherdimethoxybenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundcarboxamide groupmethoxybenzenebeta amino acid or derivativesaromatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundm-dimethoxybenzeneanisolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|