| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:10 UTC |
|---|
| Update Date | 2025-03-25 00:59:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02235973 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H26O8 |
|---|
| Molecular Mass | 370.1628 |
|---|
| SMILES | OCC1OC(Oc2cc(C3CCCCC3O)ccc2O)C(O)C(O)C1O |
|---|
| InChI Key | QBGBKMULJHXFOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | cyclohexylphenols |
|---|
| Direct Parent | cyclohexylphenols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalscyclic alcohols and derivativescyclohexanolshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcohols |
|---|
| Substituents | alcoholcyclohexylphenolphenol etheraromatic heteromonocyclic compoundcyclohexanol1-hydroxy-2-unsubstituted benzenoidmonosaccharidecyclic alcoholoxacyclesaccharideorganic oxygen compoundacetalsecondary alcoholphenolhydrocarbon derivativephenoxy compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
