| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:12 UTC |
|---|
| Update Date | 2025-03-25 00:59:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236056 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H40O26S |
|---|
| Molecular Mass | 896.1529 |
|---|
| SMILES | COc1ccc(C2CC(=O)c3c(cc(OC4OC(COS(=O)(=O)O)C(O)C(O)C4O)cc3OC3OC(C(=O)O)C(O)C(O)C3O)O2)cc1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | POVBSBXSZUMQPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 4'-o-methylated flavonoidsacetalsalkyl aryl ethersalkyl sulfatesanisolesaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acidschromonesdicarboxylic acids and derivativesflavanonesflavonoid-7-o-glycosidesglucuronic acid derivativeshydrocarbon derivativesmethoxybenzenesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyranflavanoneo-glucuronidemonosaccharidepyran carboxylic acidflavonoid-3p-o-glucuronideketone1-o-glucuronidebeta-hydroxy acidsaccharideacetalchromoneoxaneorganoheterocyclic compoundalcoholbenzopyranmethoxybenzeneanisoledicarboxylic acid or derivatives4p-methoxyflavonoid-skeletonhydrocarbon derivativephenoxy compoundaryl ketonesulfuric acid monoestercarbonyl groupetherglucuronic acid or derivativesflavanalkyl aryl ethercarboxylic acid derivativeflavonoid-5-o-glucuronideorganic oxidearomatic heteropolycyclic compoundalkyl sulfatechromaneflavonoid-7-o-glycosidepyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidoxacycleorganic oxygen compoundpyransecondary alcoholsulfate-esterbenzenoidsulfuric acid esterorganooxygen compound |
|---|