| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:15 UTC |
|---|
| Update Date | 2025-03-25 00:59:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236166 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO3 |
|---|
| Molecular Mass | 299.1521 |
|---|
| SMILES | COc1ccc(C(O)(CCNC(C)=O)c2ccccc2)cc1 |
|---|
| InChI Key | OXDQLQPILCKGNN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersanisolesaromatic alcoholscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | aromatic alcoholdiphenylmethanephenol ethercarbonyl groupetheralkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidealcoholcarboxamide groupmethoxybenzenearomatic homomonocyclic compoundsecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
