| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:15 UTC |
|---|
| Update Date | 2025-03-25 00:59:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236178 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14NO5P |
|---|
| Molecular Mass | 223.061 |
|---|
| SMILES | COP1(=O)CC(O)C(NC(C)=O)CO1 |
|---|
| InChI Key | LTXKFIOIIFIPMR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | phosphonic acid diesters |
|---|
| Direct Parent | dialkyl alkylphosphonates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphosphacyclic compoundsphosphonic acid esterssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholdialkyl alkylphosphonatecarbonyl groupcarboxamide groupcarboxylic acid derivativephosphacyclephosphonic acid esteroxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundacetamideorganooxygen compound |
|---|
