| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:16 UTC |
|---|
| Update Date | 2025-03-25 00:59:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236190 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO3 |
|---|
| Molecular Mass | 257.1052 |
|---|
| SMILES | Oc1ccc(C2Nc3cccc(O)c3CC2O)cc1 |
|---|
| InChI Key | ZZIDWPOIGHKENI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | phenylquinolines |
|---|
| Direct Parent | phenylquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativeshydroquinolinesorganopnictogen compoundssecondary alcoholssecondary alkylarylamines |
|---|
| Substituents | alcoholmonocyclic benzene moietyazacyclephenylquinoline1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundtetrahydroquinolineamineorganooxygen compound |
|---|
