| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:16 UTC |
|---|
| Update Date | 2025-03-25 00:59:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236206 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16ClNO4S |
|---|
| Molecular Mass | 329.0489 |
|---|
| SMILES | CSCCC(NC(=O)C=Cc1ccc(O)c(Cl)c1)C(=O)O |
|---|
| InChI Key | DDMCFYSFLKFXJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | methionine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsaryl chloridescarbonyl compoundscarboxylic acidschlorobenzenesdialkylthioethersfatty acylshalophenolshydrocarbon derivativeshydroxy fatty acidshydroxycinnamic acidsmonocarboxylic acids and derivativesn-acyl-alpha amino acidso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compoundsthia fatty acids |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidorganochloride1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundorganohalogen compoundhydroxycinnamic acid or derivativescinnamic acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydroxy fatty acidn-acyl-alpha amino acid or derivativesaryl chloride2-chlorophenolchlorobenzenesulfenyl compoundn-acyl-alpha-amino aciddialkylthioethercarboxamide grouphydroxycinnamic acidaryl halidearomatic homomonocyclic compound2-halophenolsecondary carboxylic acid amidemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioethermethionine or derivativesphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|