| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:18 UTC |
|---|
| Update Date | 2025-03-25 00:59:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236263 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15ClO |
|---|
| Molecular Mass | 186.0811 |
|---|
| SMILES | OC12CC3CC(C1)CC(Cl)(C3)C2 |
|---|
| InChI Key | QUHCTPODJFWZRX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | tertiary alcohols |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridescyclic alcohols and derivativeshydrocarbon derivativesorganochlorides |
|---|
| Substituents | tertiary alcoholalkyl chlorideorganochloridealkyl halidehydrocarbon derivativecyclic alcoholorganohalogen compoundaliphatic homopolycyclic compound |
|---|
