| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:21 UTC |
|---|
| Update Date | 2025-03-25 00:59:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236372 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16O2S |
|---|
| Molecular Mass | 224.0871 |
|---|
| SMILES | CSc1ccc(C(C)(C)C)cc1C(=O)O |
|---|
| InChI Key | SHFLZUIELHJRNP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | o-sulfanylbenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalkylarylthioethersbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenylpropanessulfenyl compoundsthiophenol ethersthiophenolsvinylogous thioesters |
|---|
| Substituents | carboxylic acidbenzoylalkylarylthioetherorganosulfur compoundcarboxylic acid derivativearyl thioetherphenylpropaneorganic oxidethiophenolo-sulfanylbenzoic acidthiophenol ether1-carboxy-2-haloaromatic compoundbenzoic acidvinylogous thioestersulfenyl compoundaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundthioetherhydrocarbon derivativeorganooxygen compound |
|---|