| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:21 UTC |
|---|
| Update Date | 2025-03-25 00:59:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236373 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O5 |
|---|
| Molecular Mass | 254.1154 |
|---|
| SMILES | COC1OC(Cc2ccccc2)C(O)C(O)C1O |
|---|
| InChI Key | WORWUTKFCLCVPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharideoxacycleacetalsecondary alcoholhydrocarbon derivativebenzenoidoxaneorganoheterocyclic compound |
|---|
