| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:26 UTC |
|---|
| Update Date | 2025-03-25 00:59:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236563 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H19N3O3 |
|---|
| Molecular Mass | 385.1426 |
|---|
| SMILES | COc1ccc2nccc(Oc3ccc(NC(=O)Nc4ccccc4)cc3)c2c1 |
|---|
| InChI Key | ZDDIUINPUKVAMJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl aryl ethersanisolesazacyclic compoundscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesmethylpyridinesn-phenylureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspolyhalopyridinesquinolines and derivatives |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarbonyl grouppolyhalopyridinealkyl aryl etherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compound2-halopyridineorganoheterocyclic compoundcarbonic acid derivativeazacycleheteroaromatic compoundmethylpyridinen-phenylureapyridineanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|
