| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:26 UTC |
|---|
| Update Date | 2025-03-25 00:59:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236584 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N2O2 |
|---|
| Molecular Mass | 258.1368 |
|---|
| SMILES | COc1ccc2cccc(NC(=O)CN(C)C)c2c1 |
|---|
| InChI Key | XKDTVZWUGGCKHM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha amino acidsanisolescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesnaphthalenesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | phenol ethercarbonyl groupethern-arylamidealkyl aryl etherorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary aminealpha-amino acid amidetertiary aliphatic aminearomatic homopolycyclic compoundcarboxamide groupsecondary carboxylic acid amidenaphthaleneorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|