| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:27 UTC |
|---|
| Update Date | 2025-03-25 00:59:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236597 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H12BrNO2 |
|---|
| Molecular Mass | 341.0051 |
|---|
| SMILES | COc1ccc2nccc(C(=O)c3ccc(Br)cc3)c2c1 |
|---|
| InChI Key | WNNJOOHELPVSQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | aryl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl aryl ethersanisolesaryl bromidesaryl ketonesazacyclic compoundsbenzoyl derivativesbromobenzenesheteroaromatic compoundshydrocarbon derivativesmethylpyridinesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridinecarboxylic acids and derivativesquinolines and derivatives |
|---|
| Substituents | pyridine carboxylic acid or derivativesphenol ethermonocyclic benzene moietyetherpolyhalopyridinebenzoylalkyl aryl etherorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compound2-halopyridineorganoheterocyclic compoundazacyclearyl-phenylketoneheteroaromatic compoundbromobenzenemethylpyridinearyl halidepyridineanisoleorganobromidehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenearyl bromide |
|---|