DeepMet

Record Information
HMDB Status	expected
Creation Date	2024-02-21 15:15:27 UTC
Update Date	2025-03-25 00:59:22 UTC
HMDB ID	HMDB0029356
Metabolite Identification
DeepMet ID	DMID02236624
Name	N-Feruloylglycyl-L-phenylalanine
Frequency	0.5
Structure
Chemical Formula	C₂₁H₂₂N₂O₆
Molecular Mass	398.1478
SMILES	COc1cc(C=CC(=O)NCC(=O)NC(Cc2ccccc2)C(=O)O)ccc1O
InChI Key	RMZPPYWIJILVLC-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	dipeptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alkyl aryl ethers alpha amino acid amides alpha amino acids amphetamines and derivatives anisoles carbonyl compounds carboxylic acids hydrocarbon derivatives hydroxycinnamic acids methoxybenzenes methoxyphenols monocarboxylic acids and derivatives n-acyl-alpha amino acids organic oxides organonitrogen compounds organopnictogen compounds phenoxy compounds phenylalanine and derivatives phenylpropanoic acids secondary carboxylic acid amides
Substituents	phenol ether monocyclic benzene moiety carbonyl group ether carboxylic acid 3-phenylpropanoic-acid 1-hydroxy-2-unsubstituted benzenoid methoxyphenol alpha-amino acid or derivatives alkyl aryl ether hydroxycinnamic acid or derivatives cinnamic acid or derivatives organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives n-acyl-alpha amino acid or derivatives alpha-amino acid amide n-acyl-alpha-amino acid carboxamide group methoxybenzene n-substituted-alpha-amino acid hydroxycinnamic acid aromatic homomonocyclic compound alpha-dipeptide secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound anisole phenol hydrocarbon derivative benzenoid organic nitrogen compound phenoxy compound organooxygen compound

Showing information for DMID02236624