| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:28 UTC |
|---|
| Update Date | 2025-03-25 00:59:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236648 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H31NO10 |
|---|
| Molecular Mass | 493.1948 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC4OC(C(=O)O)C(O)C(O)C4O)CC4C(O)C(C2)N(C)CCC341 |
|---|
| InChI Key | VEQRRFAVYHDMNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetalsalkyl aryl ethersamino acidsanisolesazacyclic compoundsazepanesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscoumaransglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstrialkylamines |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidamino acid or derivativesamino acido-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanetertiary amineorganoheterocyclic compoundcoumaranalcoholpyran carboxylic acid or derivativesazacycle1,2-aminoalcoholtertiary aliphatic aminehydroxy acidoxacyclemonocarboxylic acid or derivativesazepanepyrananisolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundamine |
|---|
