| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:30 UTC |
|---|
| Update Date | 2025-03-25 00:59:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236702 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H24N4O3S |
|---|
| Molecular Mass | 292.1569 |
|---|
| SMILES | CS(=O)(=O)N1CCN(C(=O)C(N)CCCCN)CC1 |
|---|
| InChI Key | UKHMTXDEWRBMTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganic sulfonamidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidespiperazinessulfonylstertiary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouporganosulfur compoundorganosulfonic acid amideorganic oxidepiperazinetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundalpha-amino acid amideazacyclecarboxamide groupsulfonylorganic oxygen compoundorganic sulfonic acid or derivatives1,4-diazinanehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
|---|
