| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:30 UTC |
|---|
| Update Date | 2025-03-25 00:59:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236713 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19ClN4O2S |
|---|
| Molecular Mass | 330.0917 |
|---|
| SMILES | CS(=O)CCCCNC(=O)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | ANDHNKXJJSBFDW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboximidamidesguanidineshydrocarbon derivativesiminesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundssulfinyl compoundssulfoxides |
|---|
| Substituents | carbonyl groupguanidineimineorganochlorideorganosulfur compoundorganohalogen compoundorganic oxidesulfinyl compoundorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenecarbonic acid derivativecarboximidamidearyl halidearomatic homomonocyclic compoundorganic oxygen compoundsulfoxidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
