| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:32 UTC |
|---|
| Update Date | 2025-03-25 00:59:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236797 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13IN2O4 |
|---|
| Molecular Mass | 411.992 |
|---|
| SMILES | COc1cc(C2(c3ccc(O)cc3)N=C(O)N2)cc(I)c1O |
|---|
| InChI Key | HZGQIVVMDPTMDO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaryl iodidesazacyclic compoundscarbonyl compoundsdiazetidineshalophenolshydrocarbon derivativesiodobenzenesmethoxybenzenesmethoxyphenolso-iodophenolsorganic carbonic acids and derivativesorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compounds |
|---|
| Substituents | diphenylmethanephenol ethercarbonyl groupetheraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganohalogen compoundiodobenzeneorganoiodideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compound1,3-diazetidinecarbonic acid derivativeazacycle2-iodophenolmethoxybenzenearyl halide2-halophenolorganic oxygen compoundanisolephenolhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compound |
|---|
