| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:32 UTC |
|---|
| Update Date | 2025-03-25 00:59:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236802 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O5 |
|---|
| Molecular Mass | 230.0903 |
|---|
| SMILES | COc1ccn(C2OC(CO)C(O)C2O)n1 |
|---|
| InChI Key | TURIKSTZVIOXGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrazole ribonucleosides and ribonucleotides |
|---|
| Subclass | pyrazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | pyrazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrazolessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholetheraromatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharidealkyl aryl etherpyrazole1-ribofuranosylpyrazoleoxacyclesaccharideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compoundazole |
|---|
