| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:32 UTC |
|---|
| Update Date | 2025-03-25 00:59:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236805 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11NO6 |
|---|
| Molecular Mass | 301.0586 |
|---|
| SMILES | COc1cnc2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1 |
|---|
| InChI Key | IRHFNTGZPVNJFI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyranopyridines |
|---|
| Subclass | pyranopyridines |
|---|
| Direct Parent | pyranopyridines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-halopyridinesalkyl aryl ethersazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinespyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietyetherpolyhalopyridine1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compound2-halopyridineazacycleheteroaromatic compoundhydroxypyridinemethylpyridine1-hydroxy-4-unsubstituted benzenoidoxacyclepyridineorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundpyranopyridineorganooxygen compound |
|---|
