| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:33 UTC |
|---|
| Update Date | 2025-03-25 00:59:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02236819 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11O7P |
|---|
| Molecular Mass | 214.0242 |
|---|
| SMILES | CP(=O)(O)OC(O)C(O)C(=O)CO |
|---|
| InChI Key | FGCVDYIRIFPBNH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | phosphonic acid esters |
|---|
| Direct Parent | phosphonic acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesbeta-hydroxy ketoneshydrocarbon derivativesmonosaccharidesorganic oxidesorganophosphorus compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupmonosaccharidealpha-hydroxy ketoneketonephosphonic acid estersaccharideorganic oxideorganic oxygen compoundacyloinsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganooxygen compound |
|---|
