| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:38 UTC |
|---|
| Update Date | 2025-03-25 00:59:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237003 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO4 |
|---|
| Molecular Mass | 283.0845 |
|---|
| SMILES | O=C(c1c[nH]c2ccccc12)C(O)c1ccc(O)c(O)c1 |
|---|
| InChI Key | VXINUVFEVFDHGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | phenylacetylindoles |
|---|
| Direct Parent | phenylacetylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacyloinsaromatic alcoholsaryl alkyl ketonesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessecondary alcoholsvinylogous amides |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietyaryl alkyl ketoneindole1-hydroxy-2-unsubstituted benzenoidketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholvinylogous amideazacycleheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidorganic oxygen compoundacyloinpyrrolesecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenylacetylindoleorganooxygen compoundaryl ketone |
|---|
