| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:38 UTC |
|---|
| Update Date | 2025-03-25 00:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237026 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18N2O2 |
|---|
| Molecular Mass | 282.1368 |
|---|
| SMILES | O=C(c1ccccc1)N1CCN(c2ccccc2O)CC1 |
|---|
| InChI Key | IUMZQJUTINJZAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesaniline and substituted anilinesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganooxygen compoundsorganopnictogen compoundstertiary carboxylic acid amideso-aminophenols |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundamino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamideorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineazacycleaniline or substituted anilinesaminophenolbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxamide groupphenylpiperazineorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundo-aminophenolaminen-arylpiperazineorganooxygen compound |
|---|
