| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:39 UTC |
|---|
| Update Date | 2025-03-25 00:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237076 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17FO7 |
|---|
| Molecular Mass | 340.0958 |
|---|
| SMILES | O=C(C=Cc1ccc(F)cc1)OC1C(O)CC(O)(C(=O)O)CC1O |
|---|
| InChI Key | FHFNVEQJNIFVIH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaryl fluoridescarbonyl compoundscarboxylic acidscinnamic acids and derivativescyclohexanolsdicarboxylic acids and derivativesenoate estersfatty acid estersfluorobenzeneshydrocarbon derivativesorganic oxidesorganofluoridestertiary alcohols |
|---|
| Substituents | aryl fluoridefatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativeorganohalogen compoundalpha,beta-unsaturated carboxylic estercinnamic acid or derivativesfluorobenzeneorganic oxideenoate esterorganofluoridecyclohexanolhydroxy acidaryl halidearomatic homomonocyclic compoundfatty acid estertertiary alcoholcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidhalobenzenequinic acid |
|---|
