| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:40 UTC |
|---|
| Update Date | 2025-03-25 00:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237095 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N6O3 |
|---|
| Molecular Mass | 266.1127 |
|---|
| SMILES | Nc1ncnc2ncc(C(N)C(O)C(O)CO)nc12 |
|---|
| InChI Key | DXBXCNSOODVKGY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkylaminesorganopnictogen compoundsprimary alcoholspyrazinespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | alcoholazacycleheteroaromatic compoundpteridinepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compound |
|---|