| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237143 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H8O4 |
|---|
| Molecular Mass | 216.0423 |
|---|
| SMILES | O=C(O)c1ccc(C(=O)c2ccco2)cc1 |
|---|
| InChI Key | WCXUOPBBWAUFTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | aryl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesbenzoic acidsbenzoyl derivativescarboxylic acidsfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | furanmonocyclic benzene moietyfuroic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundaryl-phenylketoneheteroaromatic compoundbenzoylbenzoic acid or derivativescarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativeshydrocarbon derivativebenzenoidbenzoic acidorganoheterocyclic compound |
|---|
