| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237144 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H3F2O6P |
|---|
| Molecular Mass | 203.9635 |
|---|
| SMILES | O=C(O)C(=O)C(F)(F)P(=O)(O)O |
|---|
| InChI Key | ZFIQXYCEXWQINL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | alpha-keto acids and derivatives |
|---|
| Direct Parent | alpha-keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-haloketonesalpha-hydroxy ketonescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganofluoridesorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalkyl fluorideorganofluoridealpha-hydroxy ketonecarboxylic acid derivativeorganohalogen compoundketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalpha-keto acidorganopnictogen compoundalpha-haloketoneorganophosphorus compoundalkyl halidehydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
