| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:41 UTC |
|---|
| Update Date | 2025-03-25 00:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237149 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N2O4 |
|---|
| Molecular Mass | 222.0641 |
|---|
| SMILES | O=C(O)c1ccc(C(O)Cn2ccnc2)o1 |
|---|
| InChI Key | XCXBOWHPGJVUSE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholcarboxylic acidaromatic heteromonocyclic compoundcarboxylic acid derivativeorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundazolen-substituted imidazolealcoholazacycleheteroaromatic compoundfuroic acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
