| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:42 UTC |
|---|
| Update Date | 2025-03-25 00:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237165 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H7Br2IO3 |
|---|
| Molecular Mass | 495.7807 |
|---|
| SMILES | O=C(O)c1ccc(Oc2ccc(Br)cc2Br)c(I)c1 |
|---|
| InChI Key | YIQODLIHNKGJPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | bromodiphenyl ethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 3-halobenzoic acidsaryl bromidesaryl iodidesbenzoic acidsbenzoyl derivativesbromobenzenescarboxylic acidsdiarylethershalobenzoic acidshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativesorganic oxidesorganobromidesorganoiodidesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etherethercarboxylic acid3-halobenzoic acid or derivativesbenzoylbromodiphenyl ethercarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxide3-halobenzoic acidbenzoic acidhalobenzoic acidbromobenzenebenzoic acid or derivativeshalobenzoic acid or derivativesaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundorganobromidehydrocarbon derivativearyl iodidehalobenzenephenoxy compoundaryl bromideorganooxygen compound |
|---|