| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:43 UTC |
|---|
| Update Date | 2025-03-25 00:59:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237188 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O2 |
|---|
| Molecular Mass | 248.1525 |
|---|
| SMILES | O=C(NCCN1CCCCC1)c1ccccc1O |
|---|
| InChI Key | GUPFZDSJPSUBLR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundspiperidinessecondary carboxylic acid amidestrialkylaminesvinylogous acids |
|---|
| Substituents | aromatic heteromonocyclic compoundamino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundazacycletertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsalicylamidesecondary carboxylic acid amidevinylogous acidorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
