| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:44 UTC |
|---|
| Update Date | 2025-03-25 00:59:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237230 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11O3+ |
|---|
| Molecular Mass | 251.0703 |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc3ccccc3[o+]2)cc1 |
|---|
| InChI Key | RSFNWWIEKLMLRN-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | anthocyanidins |
|---|
| Direct Parent | anthocyanidins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransbenzoic acidsbenzoyl derivativescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietybenzopyrancarboxylic acid1-benzopyranheteroaromatic compoundbenzoylbenzoic acid or derivativescarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundanthocyanidinhydrocarbon derivativebenzenoidorganic cationbenzoic acidorganoheterocyclic compoundorganooxygen compound |
|---|
