| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:45 UTC |
|---|
| Update Date | 2025-03-25 00:59:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237265 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9F2O7P |
|---|
| Molecular Mass | 250.0054 |
|---|
| SMILES | O=C(CO)C(O)C(O)C(F)(F)P(=O)(O)O |
|---|
| InChI Key | YYXCCZKSENDIBU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalkyl fluoridesalpha-hydroxy ketonesbeta-hydroxy ketonesfluorohydrinshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganofluoridesorganophosphorus compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl grouphalohydrinalkyl fluorideorganofluoridemonosaccharidefluorohydrinalpha-hydroxy ketoneorganohalogen compoundketoneorganic oxideacyloinsecondary alcoholorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganophosphonic acid derivative |
|---|