| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:46 UTC |
|---|
| Update Date | 2025-03-25 00:59:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237313 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18N2O6 |
|---|
| Molecular Mass | 370.1165 |
|---|
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccccc1)n2C1OC(CO)C(O)C1O |
|---|
| InChI Key | HZEPHMSGALEDOA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | benzimidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | benzimidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | benzimidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphenylbenzimidazolesphenylimidazolesprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidearomatic heteropolycyclic compoundimidazolebenzimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycle1-ribofuranosylbenzimidazoletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compound2-phenylimidazolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundphenylbenzimidazole |
|---|