| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:47 UTC |
|---|
| Update Date | 2025-03-25 00:59:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237373 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H30N2O11 |
|---|
| Molecular Mass | 498.185 |
|---|
| SMILES | O=C(Cc1c[nH]c2ccccc12)NC1C(O)OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C1O |
|---|
| InChI Key | RGVHPCDIDSVRQL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshemiacetalsheteroaromatic compoundshydrocarbon derivativesindolesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyrrolessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupindolemonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundindole or derivativescarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
