| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:49 UTC |
|---|
| Update Date | 2025-03-25 00:59:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237430 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7N2O5P |
|---|
| Molecular Mass | 218.0093 |
|---|
| SMILES | Nc1cccc(C(=O)OP(=O)(O)O)n1 |
|---|
| InChI Key | WKJQRGZYOZQBBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridine-2-carboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesacyl phosphatesamino acids and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesimidolactamsmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesprimary amines |
|---|
| Substituents | aromatic heteromonocyclic compoundamino acid or derivativespolyhalopyridinecarboxylic acid derivativeorganic oxidepyridine-2-carboxylic acidorganonitrogen compoundorganopnictogen compound2-halopyridineimidolactamazacycleheteroaromatic compoundhydroxypyridinemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compoundacyl phosphate |
|---|
