| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:49 UTC |
|---|
| Update Date | 2025-03-25 00:59:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237434 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O6 |
|---|
| Molecular Mass | 342.1103 |
|---|
| SMILES | O=C1CC2C(c3ccc(O)cc3)OCC2C(c2ccc(O)c(O)c2)O1 |
|---|
| InChI Key | PXGRNQKOWKTJBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furopyrans |
|---|
| Subclass | furopyrans |
|---|
| Direct Parent | furopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdelta valerolactonesdialkyl ethersfuranshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanespyranstetrahydrofurans |
|---|
| Substituents | furanmonocyclic benzene moietycarbonyl groupetherdelta valerolactone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherlactoneorganic oxidearomatic heteropolycyclic compoundoxanedelta_valerolactonetetrahydrofuranfuropyran1-hydroxy-4-unsubstituted benzenoidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyrancarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|