| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:50 UTC |
|---|
| Update Date | 2025-03-25 00:59:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237450 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O4S |
|---|
| Molecular Mass | 238.03 |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2)C(C(=O)O)S1 |
|---|
| InChI Key | LJEJWWPFPQQNFP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarbothioic s-lactonescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesthioestersthiolactonesthiolanes |
|---|
| Substituents | thiolanecarbothioic s-lactonemonocyclic benzene moietythiocarboxylic acid or derivativescarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundthiocarboxylic acid ester1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativethiolactoneorganoheterocyclic compoundorganooxygen compound |
|---|
