| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:51 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237495 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H25N3O9S |
|---|
| Molecular Mass | 435.1312 |
|---|
| SMILES | Nc1ccn(C2OC(CSCC3OC(CO)C(O)C(O)C3O)C(O)C2O)c(=O)n1 |
|---|
| InChI Key | FERFSNNGDAOZJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxy-5'-thionucleosides |
|---|
| Direct Parent | 5'-s-alkylthio-5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholsprimary aminespyrimidonessecondary alcoholssulfenyl compoundstetrahydrofurans |
|---|
| Substituents | etheraromatic heteromonocyclic compoundmonosaccharidepyrimidoneorganosulfur compounddialkyl etherpyrimidinesaccharideorganic oxide5'-s-alkylthio-5'-deoxyribonucleosideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativesulfenyl compoundazacycletetrahydrofurandialkylthioetherheteroaromatic compoundoxacycleorganic oxygen compoundthioethersecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
