| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:51 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237506 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O12 |
|---|
| Molecular Mass | 414.0798 |
|---|
| SMILES | O=C1CCC(Cc2cc(O)c(OC3OC(C(=O)O)C(O)C(C(=O)O)O3)c(O)c2)O1 |
|---|
| InChI Key | WZBBTPFJODRDET-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanes1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acid orthoesterscarboxylic acidsgamma butyrolactoneshydrocarbon derivativesorganic oxidesortho estersoxacyclic compoundsphenol ethersphenoxy compoundsresorcinolssecondary alcoholstetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundortho ester1-hydroxy-2-unsubstituted benzenoidtricarboxylic acid or derivativescarboxylic acid orthoesterresorcinollactonebeta-hydroxy acidorganic oxideorthocarboxylic acid derivativeorganoheterocyclic compoundalcoholtetrahydrofuranhydroxy acid1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacycleorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundmeta-dioxaneorganooxygen compound |
|---|