| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:51 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237509 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12N2O3S |
|---|
| Molecular Mass | 300.0569 |
|---|
| SMILES | NS(=O)(=O)c1ccc(Oc2ccnc3ccccc23)cc1 |
|---|
| InChI Key | LELPTFJCMTYFAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaminosulfonyl compoundsazacyclic compoundsbenzenesulfonamidesbenzenesulfonyl compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidesphenol ethersphenoxy compoundspolyhalopyridinespyridines and derivativesquinolines and derivatives |
|---|
| Substituents | diaryl etherphenol etherorganosulfonic acid or derivativesmonocyclic benzene moietypolyhalopyridineorganosulfur compoundorganosulfonic acid amideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compound2-halopyridineorganoheterocyclic compoundbenzenesulfonyl groupbenzenesulfonamideazacycleaminosulfonyl compoundheteroaromatic compoundsulfonylpyridineorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|