| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:52 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237527 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N4O13P |
|---|
| Molecular Mass | 470.0686 |
|---|
| SMILES | Nc1c(C(=O)NC(=O)C(O)C(O)C(=O)O)ncn1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | FLDJPACEXJSJGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | imidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | 1-ribosyl-imidazolecarboxamides |
|---|
| Direct Parent | 1-ribosyl-imidazolecarboxamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesamino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarbonylimidazolescarboxylic acidsdicarboximidesheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-acyl aminesn-substituted imidazolesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundpentose phosphateamino acid or derivativesamino acidalpha-hydroxy acidmonosaccharidepentose-5-phosphatecarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedbeta-hydroxy acidsaccharideorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundimidazole-4-carbonyl groupdicarboximideorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundhydroxy acidn-acyl-amine1-ribosyl-imidazolecarboxamidecarboxylic acid imideoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
