| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:52 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237541 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23NO7 |
|---|
| Molecular Mass | 353.1475 |
|---|
| SMILES | O=C1CCC(Cc2ccc(NCC3(O)OC(CO)C(O)C3O)cc2)O1 |
|---|
| InChI Key | VMNSHGWNTJVHQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | phenylalkylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersgamma butyrolactoneshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesmonosaccharidecarboxylic acid derivativelactonesaccharideorganic oxideorganopnictogen compoundhemiacetalprimary alcoholorganoheterocyclic compoundalcoholtetrahydrofuransecondary aminegamma butyrolactonesecondary aliphatic/aromatic amineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidorganooxygen compound |
|---|