| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:52 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237544 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13NO6S |
|---|
| Molecular Mass | 239.0464 |
|---|
| SMILES | NS(=O)(=O)OCC12CC1C(O)C(O)C2O |
|---|
| InChI Key | VANCPDDUGCJKLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | cyclic alcohols and derivativeshydrocarbon derivativesorganic nitrogen compoundsorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholorganic oxideorganic sulfuric acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundcyclic alcoholorganooxygen compoundaliphatic homopolycyclic compound |
|---|
