| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:53 UTC |
|---|
| Update Date | 2025-03-25 00:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237569 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10ClNO3S |
|---|
| Molecular Mass | 283.007 |
|---|
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(O)cc2)cc1Cl |
|---|
| InChI Key | FLLXUQNEGGHNEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | biphenyls and derivatives |
|---|
| Direct Parent | chlorinated biphenyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminosulfonyl compoundsaryl chloridesbenzenesulfonamidesbenzenesulfonyl compoundschlorobenzeneshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganochloridesorganooxygen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativesorganochloride1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundorganohalogen compoundorganosulfonic acid amideorganic oxidebenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamideaminosulfonyl compoundaryl halidearomatic homomonocyclic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundhalobenzenechlorinated biphenylorganooxygen compound |
|---|
