| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:54 UTC |
|---|
| Update Date | 2025-03-25 00:59:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237628 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N5O4S |
|---|
| Molecular Mass | 297.0532 |
|---|
| SMILES | Nc1nc2ncc(SCCC(O)C(=O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | YZZLBOGWJQUPCL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersalpha hydroxy acids and derivativesamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsfatty acylsheteroaromatic compoundshydrocarbon derivativeshydroxy fatty acidslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary alcoholssulfenyl compoundsthia fatty acids |
|---|
| Substituents | fatty acylcarbonyl grouplactamcarboxylic acidamino acid or derivativesamino acidalpha-hydroxy acidmonosaccharidepyrimidonealkylarylthioetherorganosulfur compoundcarboxylic acid derivativearyl thioetherpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidalcoholpterinsulfenyl compoundazacycleheteroaromatic compoundhydroxy acidmonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioetherpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
