| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:15:56 UTC |
|---|
| Update Date | 2025-03-25 00:59:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02237673 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N5O9P |
|---|
| Molecular Mass | 391.0529 |
|---|
| SMILES | Nc1nc2nc(C(=O)O)cnc2n1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | RQLUKRMKABSOJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsamino acidsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesimidazopyrazinesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrazine carboxylic acidssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carboxylic acidimidazopyrazinepentose phosphateamino acid or derivativesamino acidpentose-5-phosphatecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesphosphoric acid esterpyrazinemonoalkyl phosphatesecondary alcoholpyrazine carboxylic acidpyrazine carboxylic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|